EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO3 |
| Net Charge | 0 |
| Average Mass | 295.338 |
| Monoisotopic Mass | 295.12084 |
| SMILES | CCOC(=O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H17NO3/c1-2-21-17(20)16-13-18(22-19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | MWKVXOJATACCCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxadifen-ethyl (CHEBI:132497) has functional parent isoxadifen (CHEBI:132496) |
| isoxadifen-ethyl (CHEBI:132497) has role agrochemical (CHEBI:33286) |
| isoxadifen-ethyl (CHEBI:132497) has role herbicide safener (CHEBI:132272) |
| isoxadifen-ethyl (CHEBI:132497) is a ethyl ester (CHEBI:23990) |
| isoxadifen-ethyl (CHEBI:132497) is a isoxazoline (CHEBI:87553) |
| IUPAC Name |
|---|
| ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
| Synonyms | Source |
|---|---|
| ethyl 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylate | Alan Wood's Pesticides |
| ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazolecarboxylate | Alan Wood's Pesticides |
| isoxadifen ethyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1576 | PPDB |
| derivatives/isoxadifen-ethyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8913194 | Reaxys |
| CAS:163520-33-0 | ChemIDplus |
| CAS:163520-33-0 | Alan Wood's Pesticides |
| Citations |
|---|