EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO3 |
| Net Charge | 0 |
| Average Mass | 295.338 |
| Monoisotopic Mass | 295.12084 |
| SMILES | CCOC(=O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C18H17NO3/c1-2-21-17(20)16-13-18(22-19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | MWKVXOJATACCCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxadifen-ethyl (CHEBI:132497) has functional parent isoxadifen (CHEBI:132496) |
| isoxadifen-ethyl (CHEBI:132497) has role agrochemical (CHEBI:33286) |
| isoxadifen-ethyl (CHEBI:132497) has role herbicide safener (CHEBI:132272) |
| isoxadifen-ethyl (CHEBI:132497) is a ethyl ester (CHEBI:23990) |
| isoxadifen-ethyl (CHEBI:132497) is a isoxazoline (CHEBI:87553) |
| IUPAC Name |
|---|
| ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
| Synonyms | Source |
|---|---|
| isoxadifen ethyl | ChEBI |
| ethyl 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylate | Alan Wood's Pesticides |
| ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazolecarboxylate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/isoxadifen-ethyl | Alan Wood's Pesticides |
| 1576 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8913194 | Reaxys |
| CAS:163520-33-0 | ChemIDplus |
| CAS:163520-33-0 | Alan Wood's Pesticides |
| Citations |
|---|