EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO3 |
| Net Charge | 0 |
| Average Mass | 267.284 |
| Monoisotopic Mass | 267.08954 |
| SMILES | O=C(O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H13NO3/c18-15(19)14-11-16(20-17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,18,19) |
| InChIKey | ITGSCCPVERXFGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide safener A compound used with herbicides that reduces the effect of the herbicide on crop plants or otherwise improves the selectivity of the herbicide for weed species over the crop plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxadifen (CHEBI:132496) has role herbicide safener (CHEBI:132272) |
| isoxadifen (CHEBI:132496) is a isoxazoline (CHEBI:87553) |
| isoxadifen (CHEBI:132496) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| isoxadifen-ethyl (CHEBI:132497) has functional parent isoxadifen (CHEBI:132496) |
| IUPAC Name |
|---|
| 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylic acid | ChemIDplus |
| 4,5-dihydro-5,5-diphenyl-3-isoxazolecarboxylic acid | Alan Wood's Pesticides |
| 5,5-diphenyl-2-isoxazoline-3-carboxylic acid | ChEBI |
| isoxadifène | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| isoxadifen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343197 | Reaxys |
| CAS:209866-92-2 | ChemIDplus |
| CAS:209866-92-2 | Alan Wood's Pesticides |