EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | [H][C@@]12CCC3=C(C(=O)C=C(C(C)C)C3=O)[C@@]1(C)CCC(C(=O)O)=C2C |
| InChI | InChI=1S/C20H24O4/c1-10(2)14-9-16(21)17-13(18(14)22)5-6-15-11(3)12(19(23)24)7-8-20(15,17)4/h9-10,15H,5-8H2,1-4H3,(H,23,24)/t15-,20-/m0/s1 |
| InChIKey | PDPFWAJAYGLYHD-YWZLYKJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (8699928) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptoquinone A (CHEBI:132352) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| triptoquinone A (CHEBI:132352) has role plant metabolite (CHEBI:76924) |
| triptoquinone A (CHEBI:132352) is a p-quinones (CHEBI:25830) |
| triptoquinone A (CHEBI:132352) is a abietane diterpenoid (CHEBI:36762) |
| triptoquinone A (CHEBI:132352) is a carbotricyclic compound (CHEBI:38032) |
| triptoquinone A (CHEBI:132352) is a cyclic terpene ketone (CHEBI:36130) |
| triptoquinone A (CHEBI:132352) is a tricyclic diterpenoid (CHEBI:79084) |
| triptoquinone A (CHEBI:132352) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (4aS,10aS)-1,4a-dimethyl-5,8-dioxo-7-(propan-2-yl)-3,4,4a,5,8,9,10,10a-octahydrophenanthrene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| (4aS-trans)-3,4,4a,5,8,9,10,10a-Octahydro-1,4a-dimethyl-7-(1-methylethyl)-5,8-dioxo-2-phenanthrenecarboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5450180 | Reaxys |
| CAS:142950-86-5 | KNApSAcK |
| CAS:142950-86-5 | ChemIDplus |
| Citations |
|---|