EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O4 |
| Net Charge | 0 |
| Average Mass | 344.451 |
| Monoisotopic Mass | 344.19876 |
| SMILES | [H][C@@]12CCc3c(OC)c(C(C)C)cc(O)c3[C@@]1(C)CCC(C(=O)O)=C2C |
| InChI | InChI=1S/C21H28O4/c1-11(2)15-10-17(22)18-14(19(15)25-5)6-7-16-12(3)13(20(23)24)8-9-21(16,18)4/h10-11,16,22H,6-9H2,1-5H3,(H,23,24)/t16-,21-/m0/s1 |
| InChIKey | NZQIHCWNAMEWEW-KKSFZXQISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (11561442) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptobenzene H (CHEBI:132351) has role plant metabolite (CHEBI:76924) |
| triptobenzene H (CHEBI:132351) is a abietane diterpenoid (CHEBI:36762) |
| triptobenzene H (CHEBI:132351) is a carbotricyclic compound (CHEBI:38032) |
| triptobenzene H (CHEBI:132351) is a monomethoxybenzene (CHEBI:25235) |
| triptobenzene H (CHEBI:132351) is a phenols (CHEBI:33853) |
| triptobenzene H (CHEBI:132351) is a tricyclic diterpenoid (CHEBI:79084) |
| triptobenzene H (CHEBI:132351) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (4aS,10aS)-5-hydroxy-8-methoxy-1,4a-dimethyl-7-(propan-2-yl)-3,4,4a,9,10,10a-hexahydrophenanthrene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C00049756 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7830097 | Reaxys |
| CAS:146900-55-2 | KNApSAcK |
| Citations |
|---|