EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O2 |
| Net Charge | 0 |
| Average Mass | 298.426 |
| Monoisotopic Mass | 298.19328 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)ccc3[C@@]1(C)CCC(C(=O)O)=C2C |
| InChI | InChI=1S/C20H26O2/c1-12(2)14-5-8-18-15(11-14)6-7-17-13(3)16(19(21)22)9-10-20(17,18)4/h5,8,11-12,17H,6-7,9-10H2,1-4H3,(H,21,22)/t17-,20-/m0/s1 |
| InChIKey | AVELPKSDGFIWLJ-PXNSSMCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (11561442) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptobenzene D (CHEBI:132350) has role plant metabolite (CHEBI:76924) |
| triptobenzene D (CHEBI:132350) is a abietane diterpenoid (CHEBI:36762) |
| triptobenzene D (CHEBI:132350) is a carbotricyclic compound (CHEBI:38032) |
| triptobenzene D (CHEBI:132350) is a tricyclic diterpenoid (CHEBI:79084) |
| triptobenzene D (CHEBI:132350) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (4aS,10aS)-1,4a-dimethyl-7-(propan-2-yl)-3,4,4a,9,10,10a-hexahydrophenanthrene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 18-norabieta-3,8,11,13-tetraene-3-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5576059 | Reaxys |
| Citations |
|---|