EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | COc1c(C(C)C)ccc2c1CCC1C(C)=C(C(=O)O)CCC21C |
| InChI | InChI=1S/C21H28O3/c1-12(2)14-6-9-18-16(19(14)24-5)7-8-17-13(3)15(20(22)23)10-11-21(17,18)4/h6,9,12,17H,7-8,10-11H2,1-5H3,(H,22,23) |
| InChIKey | UAEUNTXALQHLMF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | - | PubMed (8328267) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptoditerpenic acid B (CHEBI:132337) has role plant metabolite (CHEBI:76924) |
| triptoditerpenic acid B (CHEBI:132337) is a monomethoxybenzene (CHEBI:25235) |
| triptoditerpenic acid B (CHEBI:132337) is a tricyclic diterpenoid (CHEBI:79084) |
| triptoditerpenic acid B (CHEBI:132337) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 8-methoxy-1,4a-dimethyl-7-(propan-2-yl)-3,4,4a,9,10,10a-hexahydrophenanthrene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| NSC672174 | SUBMITTER |
| NSC 672174 | ChEBI |
| NSC-672174 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 192372 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| CAS:147362-43-4 | ChemIDplus |
| Citations |
|---|