EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O5 |
| Net Charge | 0 |
| Average Mass | 174.152 |
| Monoisotopic Mass | 174.05282 |
| SMILES | O=C(O)C1=CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12) |
| InChIKey | JXOHGGNKMLTUBP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS320) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid (CHEBI:132329) has role bacterial metabolite (CHEBI:76969) |
| 3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid (CHEBI:132329) is a cyclohexenecarboxylic acid (CHEBI:23483) |
| 3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid (CHEBI:132329) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid (CHEBI:132329) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| 3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 1063 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210054 | Reaxys |