EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2 |
| Net Charge | 0 |
| Average Mass | 228.251 |
| Monoisotopic Mass | 228.08988 |
| SMILES | O=C(O)[C@@H]1C=CCC2=C1Nc1ccccc1N2 |
| InChI | InChI=1S/C13H12N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-6,8,14-15H,7H2,(H,16,17)/t8-/m1/s1 |
| InChIKey | WGOVWFNMPRCMBJ-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylic acid (CHEBI:132306) is a aromatic amino acid (CHEBI:33856) |
| (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylic acid (CHEBI:132306) is a phenazines (CHEBI:39201) |
| (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylic acid (CHEBI:132306) is conjugate acid of (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylate (CHEBI:132005) |
| Incoming Relation(s) |
| (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylate (CHEBI:132005) is conjugate base of (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylic acid (CHEBI:132306) |
| IUPAC Name |
|---|
| (1R)-1,4,5,10-tetrahydrophenazine-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-19108 | MetaCyc |