EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6Cl2O2 |
| Net Charge | 0 |
| Average Mass | 205.040 |
| Monoisotopic Mass | 203.97448 |
| SMILES | COC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
| InChIKey | SPJQBGGHUDNAIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) has functional parent 2,5-dichlorobenzoic acid (CHEBI:132298) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) has role antifungal agrochemical (CHEBI:86328) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) has role plant growth regulator (CHEBI:26155) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) is a dichlorobenzene (CHEBI:23697) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) is a methyl ester (CHEBI:25248) |
| Synonyms | Source |
|---|---|
| 2,5-DCBME | ChEBI |
| 2,5-dichlorobenzoic acid methyl ester | ChEBI |
| Citations |
|---|