EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4Cl2O2 |
| Net Charge | 0 |
| Average Mass | 191.013 |
| Monoisotopic Mass | 189.95883 |
| SMILES | O=C(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C7H4Cl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | QVTQYSFCFOGITD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dichlorobenzoic acid (CHEBI:132298) is a chlorobenzoic acid (CHEBI:23134) |
| 2,5-dichlorobenzoic acid (CHEBI:132298) is a dichlorobenzene (CHEBI:23697) |
| Incoming Relation(s) |
| methyl 2,5-dichlorobenzoate (CHEBI:132299) has functional parent 2,5-dichlorobenzoic acid (CHEBI:132298) |
| IUPAC Name |
|---|
| 2,5-dichlorobenzoic acid |
| Citations |
|---|