EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10N2O4 |
| Net Charge | 0 |
| Average Mass | 270.244 |
| Monoisotopic Mass | 270.06406 |
| SMILES | O=C(O)c1cccc2c1Nc1cccc(C(=O)O)c1N2 |
| InChI | InChI=1S/C14H10N2O4/c17-13(18)7-3-1-5-9-11(7)16-10-6-2-4-8(14(19)20)12(10)15-9/h1-6,15-16H,(H,17,18)(H,19,20) |
| InChIKey | NIZJSPFBUVJPIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,10-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132264) is a amino dicarboxylic acid (CHEBI:36164) |
| 5,10-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132264) is a phenazines (CHEBI:39201) |
| 5,10-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132264) is conjugate acid of 5,10-dihydrophenazine-1,6-dicarboxylate (CHEBI:131979) |
| Incoming Relation(s) |
| 5,10-dihydrophenazine-1,6-dicarboxylate (CHEBI:131979) is conjugate base of 5,10-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132264) |
| IUPAC Name |
|---|
| 5,10-dihydrophenazine-1,6-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-12988 | MetaCyc |