EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10N2O4 |
| Net Charge | 0 |
| Average Mass | 270.244 |
| Monoisotopic Mass | 270.06406 |
| SMILES | [H][C@@]12Nc3cccc(C(=O)O)c3N=C1C=CC=C2C(=O)O |
| InChI | InChI=1S/C14H10N2O4/c17-13(18)7-3-1-5-9-11(7)16-10-6-2-4-8(14(19)20)12(10)15-9/h1-6,11,16H,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | INPMVLIHPFWVLB-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia lata (ncbitaxon:482957) | - | PubMed (23897464) | Strain: 383 |
| Pseudomonas fluorescens (ncbitaxon:294) | - | PubMed (23897464) | Strain: 2-79 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132263) has role bacterial metabolite (CHEBI:76969) |
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132263) is a amino dicarboxylic acid (CHEBI:36164) |
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132263) is a phenazines (CHEBI:39201) |
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132263) is conjugate acid of (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylate (CHEBI:131978) |
| Incoming Relation(s) |
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylate (CHEBI:131978) is conjugate base of (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid (CHEBI:132263) |
| IUPAC Name |
|---|
| (5aS)-5,5a-dihydrophenazine-1,6-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-19104 | MetaCyc |
| Citations |
|---|