EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N2O2 |
| Net Charge | 0 |
| Average Mass | 462.678 |
| Monoisotopic Mass | 462.32463 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C30H42N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-30(34)31-23-22-26-25-32-29-21-20-27(33)24-28(26)29/h6-7,9-10,12-13,15-16,20-21,24-25,32-33H,2-5,8,11,14,17-19,22-23H2,1H3,(H,31,34)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | QJDNHGXNNRLIGA-DOFZRALJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of fatty acid amide hydrolase (EC 3.5.1.99). signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). capsaicin receptor antagonist Any substance which blocks the painful sensation of heat caused by capsaicin acting on the TRPV1 ion channel. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoylserotonin (CHEBI:132255) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoylserotonin (CHEBI:132255) has role anti-inflammatory agent (CHEBI:67079) |
| N-arachidonoylserotonin (CHEBI:132255) has role anticonvulsant (CHEBI:35623) |
| N-arachidonoylserotonin (CHEBI:132255) has role antioxidant (CHEBI:22586) |
| N-arachidonoylserotonin (CHEBI:132255) has role capsaicin receptor antagonist (CHEBI:70774) |
| N-arachidonoylserotonin (CHEBI:132255) has role EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor (CHEBI:64033) |
| N-arachidonoylserotonin (CHEBI:132255) has role human metabolite (CHEBI:77746) |
| N-arachidonoylserotonin (CHEBI:132255) has role signalling molecule (CHEBI:62488) |
| N-arachidonoylserotonin (CHEBI:132255) is a N-acylserotonin (CHEBI:134175) |
| N-arachidonoylserotonin (CHEBI:132255) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]icosa-5,8,11,14-tetraenamide |
| Synonyms | Source |
|---|---|
| N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-(5Z,8Z,11Z,14Z)-eicosatetraenamide | SUBMITTER |
| N-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]serotonin | ChEBI |
| N-arachidonoyl-5-hydroxytryptamine | ChEBI |
| Arachidonoyl serotonin | LIPID MAPS |
| arachidonoylserotonin | ChEBI |
| Arachinonoyl 5HT | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| N-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]-serotonin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Arachidonoyl_serotonin | Wikipedia |
| LMFA08020141 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7667564 | Reaxys |
| Citations |
|---|