EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H44FeN4O12 |
| Net Charge | 0 |
| Average Mass | 828.653 |
| Monoisotopic Mass | 828.23051 |
| SMILES | CC1=C(CCC(=O)O)C2=Cc3c(CCC(=O)O)c(C)c4[n]3[Fe-2]35[N]6C(=CC1=[N+]23)[C@@H](CCC(=O)O)[C@](C)(CC(=O)O)C6=CC1=[N+]5C(=C4)[C@@](C)(CC(=O)O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C40H46N4O12.Fe/c1-19-21(5-9-33(45)46)27-14-28-22(6-10-34(47)48)20(2)26(42-28)15-31-40(4,18-38(55)56)24(8-12-36(51)52)30(44-31)16-32-39(3,17-37(53)54)23(7-11-35(49)50)29(43-32)13-25(19)41-27;/h13-16,23-24H,5-12,17-18H2,1-4H3,(H8,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56);/q;+2/p-2/t23-,24-,39+,40+;/m1./s1 |
| InChIKey | JJIIPBCQUZPJAW-MQNDWNIASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanosarcina barkeri (ncbitaxon:2208) | - | PubMed (24669201) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,18-didecarboxysirohaem (CHEBI:132253) has role bacterial metabolite (CHEBI:76969) |
| 12,18-didecarboxysirohaem (CHEBI:132253) is a heme (CHEBI:30413) |
| 12,18-didecarboxysirohaem (CHEBI:132253) is conjugate acid of 12,18-didecarboxysiroheme(6−) (CHEBI:140497) |
| Incoming Relation(s) |
| 12,18-didecarboxysiroheme(6−) (CHEBI:140497) is conjugate base of 12,18-didecarboxysirohaem (CHEBI:132253) |
| IUPAC Name |
|---|
| {3,3',3'',3'''-[(7S,8S,12S,13S)-8,13-bis(carboxymethyl)-3,8,13,17-tetramethyl-7,8,12,13-tetrahydroporphyrin-2,7,12,18-tetrayl-κ4N21,N22,N23,N24]tetra(propanoato)(2−)}iron |
| Manual Xrefs | Databases |
|---|---|
| CPD-17068 | MetaCyc |
| Citations |
|---|