EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H44FeN4O12 |
| Net Charge | 0 |
| Average Mass | 828.653 |
| Monoisotopic Mass | 828.23051 |
| SMILES | CC1=C(CCC(=O)O)C2=Cc3c(CCC(=O)O)c(C)c4[n]3[Fe-2]35[N]6C(=CC1=[N+]23)[C@@H](CCC(=O)O)[C@](C)(CC(=O)O)C6=CC1=[N+]5C(=C4)[C@@](C)(CC(=O)O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C40H46N4O12.Fe/c1-19-21(5-9-33(45)46)27-14-28-22(6-10-34(47)48)20(2)26(42-28)15-31-40(4,18-38(55)56)24(8-12-36(51)52)30(44-31)16-32-39(3,17-37(53)54)23(7-11-35(49)50)29(43-32)13-25(19)41-27;/h13-16,23-24H,5-12,17-18H2,1-4H3,(H8,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56);/q;+2/p-2/t23-,24-,39+,40+;/m1./s1 |
| InChIKey | JJIIPBCQUZPJAW-MQNDWNIASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methanosarcina barkeri (ncbitaxon:2208) | - | PubMed (24669201) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12,18-didecarboxysirohaem (CHEBI:132253) has role bacterial metabolite (CHEBI:76969) |
| 12,18-didecarboxysirohaem (CHEBI:132253) is a heme (CHEBI:30413) |
| 12,18-didecarboxysirohaem (CHEBI:132253) is conjugate acid of 12,18-didecarboxysiroheme(6−) (CHEBI:140497) |
| Incoming Relation(s) |
| 12,18-didecarboxysiroheme(6−) (CHEBI:140497) is conjugate base of 12,18-didecarboxysirohaem (CHEBI:132253) |
| IUPAC Name |
|---|
| {3,3',3'',3'''-[(7S,8S,12S,13S)-8,13-bis(carboxymethyl)-3,8,13,17-tetramethyl-7,8,12,13-tetrahydroporphyrin-2,7,12,18-tetrayl-κ4N21,N22,N23,N24]tetra(propanoato)(2−)}iron |
| Manual Xrefs | Databases |
|---|---|
| CPD-17068 | MetaCyc |
| Citations |
|---|