EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132194 - glycine-d5
| Formula | C2D5NO2 |
| Net Charge | 0 |
| Average Mass | 80.098 |
| Monoisotopic Mass | 80.06341 |
| SMILES | [2H]OC(=O)C([2H])([2H])N([2H])[2H] |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2/hD3 |
| InChIKey | DHMQDGOQFOQNFH-LGLHGEJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor An EC 2.1.2.* (hydroxymethyl-, formyl- and related transferases) inhibitor that interferes with the action of glycine hydroxymethyltransferase (EC 2.1.2.1). fundamental metabolite Any metabolite produced by all living cells. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycine-d5 (CHEBI:132194) is a deuterated compound (CHEBI:76107) |
| glycine-d5 (CHEBI:132194) is a glycine (CHEBI:15428) |
| IUPAC Name |
|---|
| (2H5)glycine |
| Synonyms | Source |
|---|---|
| (2H5)Glycine | ChemIDplus |
| pentadeuterioglycine | ChEBI |
| pentadeuteroglycine | ChEBI |
| perdeuterioglycine | ChEBI |
| perdeuteroglycine | ChEBI |
| Citations |
|---|