EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2D5NO2 |
| Net Charge | 0 |
| Average Mass | 80.098 |
| Monoisotopic Mass | 80.06341 |
| SMILES | [2H]OC(=O)C([2H])([2H])N([2H])[2H] |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1D2/hD3 |
| InChIKey | DHMQDGOQFOQNFH-LGLHGEJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida DOT-T1E (ncbitaxon:1196325) | - | MetaboLights (MTBLS319) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. fundamental metabolite Any metabolite produced by all living cells. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor An EC 2.1.2.* (hydroxymethyl-, formyl- and related transferases) inhibitor that interferes with the action of glycine hydroxymethyltransferase (EC 2.1.2.1). |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. NMDA receptor agonist An excitatory amino acid agonist which binds to NMDA receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycine-d5 (CHEBI:132194) is a deuterated compound (CHEBI:76107) |
| glycine-d5 (CHEBI:132194) is a glycine (CHEBI:15428) |
| IUPAC Name |
|---|
| (2H5)glycine |
| Synonyms | Source |
|---|---|
| (2H5)Glycine | ChemIDplus |
| pentadeuterioglycine | ChEBI |
| pentadeuteroglycine | ChEBI |
| perdeuterioglycine | ChEBI |
| perdeuteroglycine | ChEBI |
| Citations |
|---|