EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O14P3 |
| Net Charge | 0 |
| Average Mass | 523.181 |
| Monoisotopic Mass | 522.99066 |
| SMILES | [H][C@]12Nc3c(nc(N)nc3=O)N1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O14P3/c11-9-13-5-3(6(17)14-9)12-8-10(18)2(27-7(4(10)16)15(5)8)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2,4,7-8,12,16,18H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/t2-,4+,7-,8+,10+/m1/s1 |
| InChIKey | HRBCPXBJAWPPIC-FLISOKMQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (CHEBI:132069) is a cyclic purine nucleotide (CHEBI:36982) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (CHEBI:132069) is conjugate acid of (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate(4−) (CHEBI:131766) |
| Incoming Relation(s) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate(4−) (CHEBI:131766) is conjugate base of (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (CHEBI:132069) |
| Synonym | Source |
|---|---|
| 3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19179 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28243020 | Reaxys |
| Citations |
|---|