EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O14P3 |
| Net Charge | -4 |
| Average Mass | 519.149 |
| Monoisotopic Mass | 518.96155 |
| SMILES | [H][C@]12Nc3c(nc(N)nc3=O)N1[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O14P3/c11-9-13-5-3(6(17)14-9)12-8-10(18)2(27-7(4(10)16)15(5)8)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2,4,7-8,12,16,18H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/p-4/t2-,4+,7-,8+,10+/m1/s1 |
| InChIKey | HRBCPXBJAWPPIC-FLISOKMQSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate(4−) (CHEBI:131766) is a organophosphate oxoanion (CHEBI:58945) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate(4−) (CHEBI:131766) is conjugate base of (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (CHEBI:132069) |
| Incoming Relation(s) |
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (CHEBI:132069) is conjugate acid of (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate(4−) (CHEBI:131766) |
| UniProt Name | Source |
|---|---|
| (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19179 | MetaCyc |
| Citations |
|---|