EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13ClF4N2O4 |
| Net Charge | 0 |
| Average Mass | 408.735 |
| Monoisotopic Mass | 408.05000 |
| SMILES | CCOC(=O)COc1cc(-n2ncc(C(F)(F)F)c(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H13ClF4N2O4/c1-3-26-14(24)7-27-13-5-12(11(18)4-10(13)17)23-15(25)8(2)9(6-22-23)16(19,20)21/h4-6H,3,7H2,1-2H3 |
| InChIKey | DNUAYCRATWAJQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenpyr-ethyl (CHEBI:132056) has functional parent flufenpyr (CHEBI:132055) |
| flufenpyr-ethyl (CHEBI:132056) has role agrochemical (CHEBI:33286) |
| flufenpyr-ethyl (CHEBI:132056) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| flufenpyr-ethyl (CHEBI:132056) has role herbicide (CHEBI:24527) |
| flufenpyr-ethyl (CHEBI:132056) is a aromatic ether (CHEBI:35618) |
| flufenpyr-ethyl (CHEBI:132056) is a ethyl ester (CHEBI:23990) |
| flufenpyr-ethyl (CHEBI:132056) is a monochlorobenzenes (CHEBI:83403) |
| flufenpyr-ethyl (CHEBI:132056) is a monofluorobenzenes (CHEBI:83575) |
| flufenpyr-ethyl (CHEBI:132056) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| ethyl {2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1(6H)-yl]phenoxy}acetate |
| Synonyms | Source |
|---|---|
| ethyl 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl]phenoxy]acetate | Alan Wood's Pesticides |
| ethyl 2-chloro-5-[1,6-dihydro-5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-fluorophenoxyacetate | Alan Wood's Pesticides |
| S-3153 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1578 | PPDB |
| derivatives/flufenpyr-ethyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15678174 | Reaxys |
| CAS:188489-07-8 | Alan Wood's Pesticides |
| Citations |
|---|