EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9ClF4N2O4 |
| Net Charge | 0 |
| Average Mass | 380.681 |
| Monoisotopic Mass | 380.01870 |
| SMILES | Cc1c(C(F)(F)F)cnn(-c2cc(OCC(=O)O)c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C14H9ClF4N2O4/c1-6-7(14(17,18)19)4-20-21(13(6)24)10-3-11(25-5-12(22)23)8(15)2-9(10)16/h2-4H,5H2,1H3,(H,22,23) |
| InChIKey | WFZSZAXUALBVNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flufenpyr (CHEBI:132055) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| flufenpyr (CHEBI:132055) has role herbicide (CHEBI:24527) |
| flufenpyr (CHEBI:132055) is a aromatic ether (CHEBI:35618) |
| flufenpyr (CHEBI:132055) is a monocarboxylic acid (CHEBI:25384) |
| flufenpyr (CHEBI:132055) is a monochlorobenzenes (CHEBI:83403) |
| flufenpyr (CHEBI:132055) is a monofluorobenzenes (CHEBI:83575) |
| flufenpyr (CHEBI:132055) is a pyridazinone (CHEBI:26414) |
| Incoming Relation(s) |
| flufenpyr-ethyl (CHEBI:132056) has functional parent flufenpyr (CHEBI:132055) |
| IUPAC Name |
|---|
| {2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1(6H)-yl]phenoxy}acetic acid |
| Synonyms | Source |
|---|---|
| 2-[2-chloro-4-fluoro-5-[5-methyl-6-oxo-4-(trifluoromethyl)-1(6H)-pyridazinyl]phenoxy]acetic acid | Alan Wood's Pesticides |
| 2-chloro-5-[1,6-dihydro-5-methyl-6-oxo-4-(trifluoromethyl)pyridazin-1-yl]-4-fluorophenoxyacetic acid | Alan Wood's Pesticides |
| S-3153 acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| flufenpyr | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15733351 | Reaxys |
| CAS:188490-07-5 | Alan Wood's Pesticides |
| CAS:188490-07-5 | ChemIDplus |