EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O2S2 |
| Net Charge | 0 |
| Average Mass | 231.302 |
| Monoisotopic Mass | 231.01362 |
| SMILES | NC(=S)NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C7H9N3O2S2/c8-5-1-3-6(4-2-5)14(11,12)10-7(9)13/h1-4H,8H2,(H3,9,10,13) |
| InChIKey | UEMLYRZWLVXWRU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfathiourea (CHEBI:131723) has functional parent sulfanilamide (CHEBI:45373) |
| sulfathiourea (CHEBI:131723) has role antibacterial drug (CHEBI:36047) |
| sulfathiourea (CHEBI:131723) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfathiourea (CHEBI:131723) is a substituted aniline (CHEBI:48975) |
| sulfathiourea (CHEBI:131723) is a sulfonamide antibiotic (CHEBI:87228) |
| sulfathiourea (CHEBI:131723) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| 4-amino-N-carbamothioylbenzenesulfonamide |
| INNs | Source |
|---|---|
| sulfathiourea | WHO MedNet |
| sulfathiourea | WHO MedNet |
| sulfathiourée | WHO MedNet |
| sulfatiourea | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-sulfanilyl-2-thiourea | ChEBI |
| 2-Sulfanilamidothiokarbamid | ChemIDplus |
| 4-amino-N-(aminothioxomethyl)benzenesulfonamide | ChemIDplus |
| p-aminobenzenesulfonylthiourea | ChemIDplus |
| p-aminophenylsulfonylthiourea | ChemIDplus |
| R.P. 2255 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Badional | ChemIDplus |
| Fontamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3567 | DrugCentral |
| D07239 | KEGG DRUG |
| Sulfathiourea | Wikipedia |
| US2332906 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2696478 | Reaxys |
| CAS:515-49-1 | ChemIDplus |
| CAS:515-49-1 | KEGG DRUG |
| Citations |
|---|