EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO121h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1 |
| InChIKey | BJHIKXHVCXFQLS-OTWZMJIISA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-L-sorbose (CHEBI:13172) is a L-sorbose (CHEBI:17266) |
| keto-L-sorbose (CHEBI:13172) is enantiomer of keto-D-sorbose (CHEBI:13022) |
| Incoming Relation(s) |
| keto-D-sorbose (CHEBI:13022) is enantiomer of keto-L-sorbose (CHEBI:13172) |
| IUPAC Name |
|---|
| keto-L-sorbose |
| Synonym | Source |
|---|---|
| (3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one | IUPAC |
| UniProt Name | Source |
|---|---|
| keto-L-sorbose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724554 | Beilstein |
| Beilstein:3588863 | Beilstein |