EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO212h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m1/s1 |
| InChIKey | BJHIKXHVCXFQLS-PYWDMBMJSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| keto-D-sorbose (CHEBI:13022) is a D-sorbose (CHEBI:17317) |
| keto-D-sorbose (CHEBI:13022) is enantiomer of keto-L-sorbose (CHEBI:13172) |
| Incoming Relation(s) |
| keto-L-sorbose (CHEBI:13172) is enantiomer of keto-D-sorbose (CHEBI:13022) |
| IUPAC Name |
|---|
| keto-D-sorbose |
| Synonym | Source |
|---|---|
| (3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one | IUPAC |
| UniProt Name | Source |
|---|---|
| keto-D-sorbose | UniProt |