EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10F3NO3S2 |
| Net Charge | 0 |
| Average Mass | 409.410 |
| Monoisotopic Mass | 409.00542 |
| SMILES | O=C(O)c1ccc(C=C2SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H10F3NO3S2/c19-18(20,21)12-2-1-3-13(9-12)22-15(23)14(27-17(22)26)8-10-4-6-11(7-5-10)16(24)25/h1-9H,(H,24,25) |
| InChIKey | JIMHYXZZCWVCMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor A EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of channel-conductance-controlling ATPase (EC 3.6.3.49, also known as cystic fibrosis conductance regulator, CFCR). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CFTRinh-172 (CHEBI:131686) has role EC 3.6.3.49 (channel-conductance-controlling ATPase) inhibitor (CHEBI:131770) |
| CFTRinh-172 (CHEBI:131686) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| CFTRinh-172 (CHEBI:131686) is a benzoic acids (CHEBI:22723) |
| CFTRinh-172 (CHEBI:131686) is a thiazolidinone (CHEBI:48891) |
| IUPAC Name |
|---|
| 4-({4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene}methyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 5-[(4-carboxyphenyl)methylene]-2-thioxo-3-[(3-trifluoromethyl)phenyl]-4-thiazolidinone | ChEBI |
| cystic fibrosis transmembrane regulator inhibitor 172 | ChEBI |
| CFTR(inh)-172 | ChemIDplus |
| Cystic fibrosis transmembrane conductance regulator inhibitor CFTR(inh)-172 | ChemIDplus |
| (inh)-172 | ChemIDplus |
| 3-[(3-trifluoromethyl)phenyl]-5-[(3-carboxyphenyl)methylene]-2-thioxo-4-thiazolidinone | ChemIDplus |
| Brand Name | Source |
|---|---|
| C2992_SIGMA | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9949257 | Reaxys |
| CAS:307510-92-5 | ChemIDplus |
| Citations |
|---|