EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H80N8O17 |
| Net Charge | 0 |
| Average Mass | 1065.229 |
| Monoisotopic Mass | 1064.56414 |
| SMILES | [H][C@@]12C[C@@H](O)CN1C(=O)[C@H]([C@@H](C)O)NC(=O)[C@@]([H])(NC(=O)CCCCCCCC[C@@H](C)C[C@@H](C)CC)C[C@@H](O)[C@@H](O)NC(=O)[C@@H]1[C@@H](O)CCN1C(=O)[C@H]([C@H](O)CC(N)=O)NC(=O)[C@H]([C@H](O)[C@@H](O)c1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C50H80N8O17/c1-5-25(2)20-26(3)12-10-8-6-7-9-11-13-37(66)52-31-22-35(64)46(71)56-48(73)41-33(62)18-19-57(41)50(75)39(34(63)23-36(51)65)54-47(72)40(43(68)42(67)28-14-16-29(60)17-15-28)55-45(70)32-21-30(61)24-58(32)49(74)38(27(4)59)53-44(31)69/h14-17,25-27,30-35,38-43,46,59-64,67-68,71H,5-13,18-24H2,1-4H3,(H2,51,65)(H,52,66)(H,53,69)(H,54,72)(H,55,70)(H,56,73)/t25-,26+,27+,30+,31-,32-,33-,34+,35+,38-,39-,40-,41-,42-,43-,46+/m0/s1 |
| InChIKey | DQXPFAADCTZLNL-FXDJFZINSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glarea lozoyensis (ncbitaxon:101852) | - | PubMed (24270605) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. EC 2.4.1.34 (1,3-beta-glucan synthase) inhibitor A EC 2.4.1.* (hexosyltransferase) inhibitor that inhibits the action of 1,3-β-glucan synthase (EC 2.4.1.34). antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pneumocandin B0 (CHEBI:131609) has role antifungal agent (CHEBI:35718) |
| pneumocandin B0 (CHEBI:131609) has role fungal metabolite (CHEBI:76946) |
| pneumocandin B0 (CHEBI:131609) is a echinocandin (CHEBI:57248) |
| pneumocandin B0 (CHEBI:131609) is a homodetic cyclic peptide (CHEBI:24613) |
| Incoming Relation(s) |
| caspofungin (CHEBI:474180) has functional parent pneumocandin B0 (CHEBI:131609) |
| IUPAC Name |
|---|
| (10R,12S)-N-{(2R,6S,9S,11R,12R,14aS,15S,20S,23S,25aS)-20-[(1R)-3-amino-1-hydroxy-3-oxopropyl]-23-[(1S,2S)-1,2-dihydroxy-2-(4-hydroxyphenyl)ethyl]-2,11,12,15-tetrahydroxy-6-[(1R)-1-hydroxyethyl]-5,8,14,19,22,25-hexaoxotetracosahydro-1H-dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacyclohenicosin-9-yl}-10,12-dimethyltetradecanamide |
| Synonyms | Source |
|---|---|
| L-688,786 | ChemIDplus |
| pneumocardin B(0) | ChemIDplus |
| L-688786 | ChemIDplus |
| L 688,786 | ChemIDplus |
| pneumocandin B(0) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Pneumocandin_Bo | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9316734 | Reaxys |
| CAS:135575-42-7 | ChemIDplus |
| Citations |
|---|