EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3S2 |
| Net Charge | 0 |
| Average Mass | 224.307 |
| Monoisotopic Mass | 224.02893 |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H12N2O3S2/c7-3(1-12)5(9)8-4(2-13)6(10)11/h3-4,12-13H,1-2,7H2,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | OABOXRPGTFRBFZ-IMJSIDKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Cys (CHEBI:131608) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Cys (CHEBI:131608) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Cys-Cys (CHEBI:131608) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-cysteinyl-L-cysteine |
| Synonyms | Source |
|---|---|
| H-L-Cys-L-Cys-OH | ChEBI |
| H-Cys-Cys-OH | ChEBI |
| L-Cys-L-Cys | ChEBI |
| cysteinylcysteine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727378 | Reaxys |
| CAS:18048-87-8 | ChemIDplus |