EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N6O8P |
| Net Charge | 0 |
| Average Mass | 444.341 |
| Monoisotopic Mass | 444.11585 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](OC(=O)[C@@H]2CCCN2)[C@H]1O |
| InChI | InChI=1S/C15H21N6O8P/c16-12-9-13(19-5-18-12)21(6-20-9)14-10(22)11(8(28-14)4-27-30(24,25)26)29-15(23)7-2-1-3-17-7/h5-8,10-11,14,17,22H,1-4H2,(H2,16,18,19)(H2,24,25,26)/t7-,8+,10+,11+,14+/m0/s1 |
| InChIKey | VSRPBSCQACUDPU-TWBCTODHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-L-prolyl-AMP (CHEBI:131572) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| 3'-L-prolyl-AMP (CHEBI:131572) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| 3'-L-prolyl-AMP (CHEBI:131572) is a L-proline derivative (CHEBI:84186) |
| 3'-L-prolyl-AMP (CHEBI:131572) is a adenosine 5'-phosphate (CHEBI:37096) |
| 3'-L-prolyl-AMP (CHEBI:131572) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| 3'-L-prolyl-AMP (CHEBI:131572) is a α-amino acid ester (CHEBI:46874) |
| 3'-L-prolyl-AMP (CHEBI:131572) is conjugate acid of 3'-L-prolyl-AMP(1−) (CHEBI:140179) |
| Incoming Relation(s) |
| 3'-L-prolyl-AMP(1−) (CHEBI:140179) is conjugate base of 3'-L-prolyl-AMP (CHEBI:131572) |
| IUPAC Name |
|---|
| 3'-O-L-prolyladenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 3'-O-L-prolyladenosine 5'-monophosphate | ChEBI |
| 3'-O-L-prolyl-AMP | ChEBI |
| 3'-prolyl-AMP | ChEBI |
| 3'-O-prolyl-AMP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:70510 | Reaxys |