EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N |
| Net Charge | 0 |
| Average Mass | 133.194 |
| Monoisotopic Mass | 133.08915 |
| SMILES | N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9+/m1/s1 |
| InChIKey | AELCINSCMGFISI-BDAKNGLRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-tranylcypromine (CHEBI:131511) is a 2-phenylcyclopropan-1-amine (CHEBI:131512) |
| (1S,2R)-tranylcypromine (CHEBI:131511) is conjugate base of (1S,2R)-tranylcypromine(1+) (CHEBI:131520) |
| (1S,2R)-tranylcypromine (CHEBI:131511) is enantiomer of (1R,2S)-tranylcypromine (CHEBI:131510) |
| Incoming Relation(s) |
| tranylcypromine (CHEBI:9652) has part (1S,2R)-tranylcypromine (CHEBI:131511) |
| (1S,2R)-tranylcypromine(1+) (CHEBI:131520) is conjugate acid of (1S,2R)-tranylcypromine (CHEBI:131511) |
| (1R,2S)-tranylcypromine (CHEBI:131510) is enantiomer of (1S,2R)-tranylcypromine (CHEBI:131511) |
| IUPAC Name |
|---|
| (1S,2R)-2-phenylcyclopropan-1-amine |
| Synonyms | Source |
|---|---|
| (-)-Tranylcypromine | ChemIDplus |
| l-Tranylcypromine | ChemIDplus |
| trans-(-)-2-Phenylcyclopropanamine | ChemIDplus |
| trans-2-phenylcyclopropan-1-amine | ChEBI |
| (1S,2R)-trans-tranylcypromine | ChEBI |
| (1S,2R)-2-phenyl-1-cyclopropanamine | ChEBI |