EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O2 |
| Net Charge | 0 |
| Average Mass | 234.339 |
| Monoisotopic Mass | 234.16198 |
| SMILES | [H][C@@]12C[C@@]3([H])[C@@]([H])(C1)[C@@]3(C)[C@]2(C)CC/C=C(\C)C(=O)O |
| InChI | InChI=1S/C15H22O2/c1-9(13(16)17)5-4-6-14(2)10-7-11-12(8-10)15(11,14)3/h5,10-12H,4,6-8H2,1-3H3,(H,16,17)/b9-5+/t10-,11+,12-,14-,15+/m1/s1 |
| InChIKey | NZSCHTYUGUVLHG-JPPNKFBCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | - | MetaboLights (MTBLS297) | |
| Solanum habrochaites (ncbitaxon:62890) | - | MetaboLights (MTBLS297) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-santalenoic acid (CHEBI:131503) has parent hydride (+)-α-santalene (CHEBI:61677) |
| α-santalenoic acid (CHEBI:131503) has role insecticide (CHEBI:24852) |
| α-santalenoic acid (CHEBI:131503) has role plant metabolite (CHEBI:76924) |
| α-santalenoic acid (CHEBI:131503) is a bridged compound (CHEBI:35990) |
| α-santalenoic acid (CHEBI:131503) is a sesquiterpenoid (CHEBI:26658) |
| α-santalenoic acid (CHEBI:131503) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-5-[(1R,2S,3R,4S,6R)-2,3-dimethyltricyclo[2.2.1.02,6]heptan-3-yl]-2-methylpent-2-enoic acid |
| Synonyms | Source |
|---|---|
| (+)-α-santalenoic acid | ChEBI |
| (E)-α-santalenoic acid | ChEBI |
| Citations |
|---|