EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H81NO21 |
| Net Charge | 0 |
| Average Mass | 1032.184 |
| Monoisotopic Mass | 1031.53011 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](CO)[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O[C@@H]6OC[C@@H](O)[C@H](O)[C@H]6O)[C@H]5O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@@]3(CC[C@H](C)CN3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C50H81NO21/c1-20-7-12-50(51-15-20)21(2)32-28(72-50)14-26-24-6-5-22-13-23(8-10-48(22,3)25(24)9-11-49(26,32)4)65-45-40(63)37(60)41(31(18-54)68-45)69-47-43(71-46-39(62)36(59)34(57)29(16-52)66-46)42(35(58)30(17-53)67-47)70-44-38(61)33(56)27(55)19-64-44/h5,20-21,23-47,51-63H,6-19H2,1-4H3/t20-,21-,23-,24+,25-,26-,27+,28-,29+,30+,31+,32-,33-,34+,35+,36-,37+,38+,39+,40+,41-,42-,43+,44-,45+,46-,47-,48-,49-,50-/m0/s1 |
| InChIKey | BYMOGFTUZUEFHY-SIUCFGLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum habrochaites (ncbitaxon:62890) | - | MetaboLights (MTBLS297) | |
| Solanum lycopersicum (ncbitaxon:4081) | - | MetaboLights (MTBLS297) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytotoxin Any toxin produced by a plant. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dehydrotomatine (CHEBI:131494) has functional parent tomatine (CHEBI:9630) |
| 5,6-dehydrotomatine (CHEBI:131494) has role antifungal agent (CHEBI:35718) |
| 5,6-dehydrotomatine (CHEBI:131494) has role phytotoxin (CHEBI:38231) |
| 5,6-dehydrotomatine (CHEBI:131494) has role plant metabolite (CHEBI:76924) |
| 5,6-dehydrotomatine (CHEBI:131494) is a alkaloid antibiotic (CHEBI:86322) |
| 5,6-dehydrotomatine (CHEBI:131494) is a glycoside (CHEBI:24400) |
| 5,6-dehydrotomatine (CHEBI:131494) is a steroid alkaloid (CHEBI:26767) |
| 5,6-dehydrotomatine (CHEBI:131494) is a tetrasaccharide derivative (CHEBI:63567) |
| IUPAC Name |
|---|
| (3β,25S)-spirosol-5-en-3-yl β-D-glucopyranosyl-(1→2)-[β-D-xylopyranosyl-(1→3)]-β-D-glucopyranosyl-(1→4)-β-D-galactopyranoside |
| Synonym | Source |
|---|---|
| dehydrotomatin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032002 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7902175 | Reaxys |
| CAS:157604-98-3 | HMDB |
| Citations |
|---|