EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H3BrO3 |
| Net Charge | 0 |
| Average Mass | 166.958 |
| Monoisotopic Mass | 165.92656 |
| SMILES | O=C(O)C(=O)CBr |
| InChI | InChI=1S/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
| InChIKey | PRRZDZJYSJLDBS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-bromopyruvic acid (CHEBI:131461) has functional parent pyruvic acid (CHEBI:32816) |
| 3-bromopyruvic acid (CHEBI:131461) has role alkylating agent (CHEBI:22333) |
| 3-bromopyruvic acid (CHEBI:131461) has role antineoplastic agent (CHEBI:35610) |
| 3-bromopyruvic acid (CHEBI:131461) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3-bromopyruvic acid (CHEBI:131461) is a organobromine compound (CHEBI:37141) |
| 3-bromopyruvic acid (CHEBI:131461) is conjugate acid of 3-bromopyruvate (CHEBI:131592) |
| Incoming Relation(s) |
| 3-bromopyruvate (CHEBI:131592) is conjugate base of 3-bromopyruvic acid (CHEBI:131461) |
| IUPAC Name |
|---|
| 3-bromo-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 3-BP | SUBMITTER |
| 3-Bromopyruvate | ChemIDplus |
| bromopyruvate | SUBMITTER |
| bromopyruvic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 3-BROMOPYRUVATE | MetaCyc |
| Bromopyruvic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1746786 | Reaxys |
| CAS:1113-59-3 | ChemIDplus |
| Citations |
|---|