EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H4O4 |
| Net Charge | 0 |
| Average Mass | 104.061 |
| Monoisotopic Mass | 104.01096 |
| SMILES | O=C(O)/C(O)=C/O |
| InChI | InChI=1S/C3H4O4/c4-1-2(5)3(6)7/h1,4-5H,(H,6,7)/b2-1- |
| InChIKey | XHDBNNIXWWTOFN-UPHRSURJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-2,3-dihydroxyacrylic acid (CHEBI:131382) has functional parent acrylic acid (CHEBI:18308) |
| (2Z)-2,3-dihydroxyacrylic acid (CHEBI:131382) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (2Z)-2,3-dihydroxyacrylic acid (CHEBI:131382) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z)-2,3-dihydroxyprop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4925681 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8541493 | Reaxys |