EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H55ClF3N5O6S3 |
| Net Charge | 0 |
| Average Mass | 974.634 |
| Monoisotopic Mass | 973.29551 |
| SMILES | CC1(C)CCC(c2ccc(Cl)cc2)=C(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(N[C@H](CCN5CCOCC5)CSc5ccccc5)c(S(=O)(=O)C(F)(F)F)c4)cc3)CC2)C1 |
| InChI | InChI=1S/C47H55ClF3N5O6S3/c1-46(2)20-18-42(34-8-12-37(48)13-9-34)36(31-46)32-55-22-24-56(25-23-55)39-14-10-35(11-15-39)45(57)53-65(60,61)41-16-17-43(44(30-41)64(58,59)47(49,50)51)52-38(19-21-54-26-28-62-29-27-54)33-63-40-6-4-3-5-7-40/h3-17,30,38,52H,18-29,31-33H2,1-2H3,(H,53,57)/t38-/m1/s1 |
| InChIKey | JLYAXFNOILIKPP-KXQOOQHDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | B-cell lymphoma 2 inhibitor Any inhibitor of B-cell lymphoma 2 protein. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| navitoclax (CHEBI:131174) has role antineoplastic agent (CHEBI:35610) |
| navitoclax (CHEBI:131174) has role apoptosis inducer (CHEBI:68495) |
| navitoclax (CHEBI:131174) has role B-cell lymphoma 2 inhibitor (CHEBI:133022) |
| navitoclax (CHEBI:131174) is a N-sulfonylcarboxamide (CHEBI:90852) |
| navitoclax (CHEBI:131174) is a aryl sulfide (CHEBI:35683) |
| navitoclax (CHEBI:131174) is a monochlorobenzenes (CHEBI:83403) |
| navitoclax (CHEBI:131174) is a morpholines (CHEBI:38785) |
| navitoclax (CHEBI:131174) is a organofluorine compound (CHEBI:37143) |
| navitoclax (CHEBI:131174) is a piperazines (CHEBI:26144) |
| navitoclax (CHEBI:131174) is a secondary amino compound (CHEBI:50995) |
| navitoclax (CHEBI:131174) is a sulfone (CHEBI:35850) |
| navitoclax (CHEBI:131174) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 4-{4-[(4'-chloro-4,4-dimethyl-3,4,5,6-tetrahydro[biphenyl]-2-yl)methyl]piperazin-1-yl}-N-[(4-{[(2R)-4-(morpholin-4-yl)-1-(phenylsulfanyl)butan-2-yl]amino}-3-[(trifluoromethyl)sulfonyl]phenyl)sulfonyl]benzamide |
| INNs | Source |
|---|---|
| navitoclax | WHO MedNet |
| navitoclax | WHO MedNet |
| navitoclax | WHO MedNet |
| navitoclaxum | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-855071.0 | ChemIDplus |
| ABT 263 | ChemIDplus |
| ABT-263 | ChemIDplus |
| ABT263 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:923564-51-6 | ChemIDplus |
| Citations |
|---|