EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O |
| Net Charge | 0 |
| Average Mass | 440.756 |
| Monoisotopic Mass | 440.40182 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](O)CC[C@@]34C[C@@]14CC[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC(=C)C(C)C |
| InChI | InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h20,22-26,32H,3,9-19H2,1-2,4-8H3/t22-,23-,24+,25+,26+,28-,29+,30-,31+/m1/s1 |
| InChIKey | BDHQMRXFDYJGII-UEBIAWITSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cheilocostus speciosus (ncbitaxon:49577) | rhizome (BTO:0001181) | PubMed (28480734) | |
| Epidendrum madsenii (ncbitaxon:1401836) | - | PubMed (17691046) | |
| Euphorbia guyoniana (ncbitaxon:1138347) | root (BTO:0001188) | PubMed (17337022) | |
| Euphorbia peplus (ncbitaxon:38846) | latex (BTO:0000710) | PubMed (10691725) | |
| Ficus carica (ncbitaxon:3494) | leaf (BTO:0000713) | PubMed (17265335) | |
| Psychotria viridis (ncbitaxon:189196) | leaf (BTO:0000713) | PubMed (28640347) | |
| Sideritis discolor (ncbitaxon:403019) | - | PubMed (19535115) | |
| Sparganium stoloniferum (ncbitaxon:203643) | rhizome (BTO:0001181) | PubMed (20422359) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-methylenecycloartanol (CHEBI:1307) has parent hydride cycloartane (CHEBI:37778) |
| 24-methylenecycloartanol (CHEBI:1307) has role plant metabolite (CHEBI:76924) |
| 24-methylenecycloartanol (CHEBI:1307) is a 3β-hydroxy steroid (CHEBI:36836) |
| 24-methylenecycloartanol (CHEBI:1307) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 24-methylene-9β-9,19-cyclolanostane-3β,28-diol (CHEBI:142917) has functional parent 24-methylenecycloartanol (CHEBI:1307) |
| IUPAC Name |
|---|
| 24-methylene-9β,19-cyclolanostan-3β-ol |
| Synonyms | Source |
|---|---|
| 24(28)-methylenecycloartanol | MetaCyc |
| 24-methylene-9β,19-cyclo-lanostan-3β-ol | LIPID MAPS |
| 24-methylenecycloartan-3β-ol | KNApSAcK |
| 24-methylene cycloartanol | ChemIDplus |
| 24-methylene-cycloartanol | LIPID MAPS |
| 24-methylenecycloartanol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 24-methylenecycloartanol | UniProt |
| Citations |
|---|