EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2122h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | FBPFZTCFMRRESA-JGWLITMVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. sweetening agent Substance that sweeten food, beverages, medications, etc. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | sweetening agent Substance that sweeten food, beverages, medications, etc. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucitol (CHEBI:17924) has role Escherichia coli metabolite (CHEBI:76971) |
| D-glucitol (CHEBI:17924) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| D-glucitol (CHEBI:17924) has role cathartic (CHEBI:75325) |
| D-glucitol (CHEBI:17924) has role food humectant (CHEBI:77969) |
| D-glucitol (CHEBI:17924) has role human metabolite (CHEBI:77746) |
| D-glucitol (CHEBI:17924) has role laxative (CHEBI:50503) |
| D-glucitol (CHEBI:17924) has role metabolite (CHEBI:25212) |
| D-glucitol (CHEBI:17924) has role mouse metabolite (CHEBI:75771) |
| D-glucitol (CHEBI:17924) has role sweetening agent (CHEBI:50505) |
| D-glucitol (CHEBI:17924) is a glucitol (CHEBI:30911) |
| D-glucitol (CHEBI:17924) is enantiomer of L-glucitol (CHEBI:28789) |
| Incoming Relation(s) |
| D-glucitol 3-phosphate (CHEBI:21092) has functional parent D-glucitol (CHEBI:17924) |
| D-glucitol 6-phosphate (CHEBI:17044) has functional parent D-glucitol (CHEBI:17924) |
| 1,5-anhydro-D-glucitol (CHEBI:16070) has functional parent D-glucitol (CHEBI:17924) |
| 6-O-α-D-glucopyranosyl-D-glucitol (CHEBI:152898) has functional parent D-glucitol (CHEBI:17924) |
| cellobiotol (CHEBI:152395) has functional parent D-glucitol (CHEBI:17924) |
| gentiobiitol (CHEBI:150274) has functional parent D-glucitol (CHEBI:17924) |
| maltitol (CHEBI:68428) has functional parent D-glucitol (CHEBI:17924) |
| α-D-Galp-(1→6)-D-Glc-OH (CHEBI:153263) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-D-Glc-OH (CHEBI:151453) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→3)-D-Glc-OH (CHEBI:148578) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→2)-β-D-Galp-(1→4)-D-Glu-OH (CHEBI:152991) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→3)-[β-D-Galp-(1→4)]-D-Glc-ol (CHEBI:146034) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Fucp-(1→4)-[β-D-Galp-(1→3)]-β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-D-Glc-ol (CHEBI:62529) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Rhap-(1→2)-[α-L-Rhap-(1→2)-α-D-Galp-(1→3)-β-D-GlcpNAc-(1→4)]-α-L-Rhap-(1→2)-α-L-Rhap-(1→1')-[α-L-Rhap-(1→3')]-D-glucitol (CHEBI:62489) has functional parent D-glucitol (CHEBI:17924) |
| α-L-Rhap-(1→3)-D-glucitol (CHEBI:61784) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Gal-(1→3)-β-D-GlcNAc-(1→3)-[β-D-GlcNAc-(1→6)]-β-D-Gal-(1→4)-D-Glc-ol (CHEBI:62661) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Galp-(1→3)-[α-L-Fucp-(1→4)]-β-D-GlcpNAc-(1→3)-β-D-Galp-(1→4)-[α-L-Fucp-(1→3)]-D-Glc-ol (CHEBI:62525) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Glcp-(1→2)-D-Glc-OH (CHEBI:153954) has functional parent D-glucitol (CHEBI:17924) |
| β-D-Glcp-(1→3)-D-Glc-OH (CHEBI:154588) has functional parent D-glucitol (CHEBI:17924) |
| β-D-GlcNAc-(1→3)-[β-D-GlcNAc-(1→6)]-β-D-Gal-(1→4)-D-Glc-ol (CHEBI:62660) has functional parent D-glucitol (CHEBI:17924) |
| D-sorbitol-13C6 (CHEBI:138264) is a D-glucitol (CHEBI:17924) |
| L-glucitol (CHEBI:28789) is enantiomer of D-glucitol (CHEBI:17924) |
| IUPAC Name |
|---|
| D-glucitol |
| Synonyms | Source |
|---|---|
| (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol | IUPAC |
| D-Glucitol | KEGG COMPOUND |
| D-Sorbitol | KEGG COMPOUND |
| D-SORBITOL | PDBeChem |
| E 420 | ChEBI |
| E-420 | ChEBI |
| UniProt Name | Source |
|---|---|
| D-sorbitol | UniProt |
| Citations |
|---|