EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N6O5S |
| Net Charge | 0 |
| Average Mass | 384.418 |
| Monoisotopic Mass | 384.12159 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O5S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | ZJUKTBDSGOFHSH-WFMPWKQPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of site-specific DNA-methyltransferase (adenine-specific), EC 2.1.1.72. EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of cyclopropane fatty acid synthase (EC 2.1.1.79). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role cofactor (CHEBI:23357) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role EC 2.1.1.72 [site-specific DNA-methyltransferase (adenine-specific)] inhibitor (CHEBI:65065) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role EC 2.1.1.79 (cyclopropane-fatty-acyl-phospholipid synthase) inhibitor (CHEBI:65064) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role epitope (CHEBI:53000) |
| S-adenosyl-L-homocysteine (CHEBI:16680) has role fundamental metabolite (CHEBI:78675) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a adenosines (CHEBI:22260) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a homocysteine derivative (CHEBI:136505) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a homocysteines (CHEBI:24610) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is a organic sulfide (CHEBI:16385) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is conjugate acid of S-adenosyl-L-homocysteinate (CHEBI:67009) |
| S-adenosyl-L-homocysteine (CHEBI:16680) is tautomer of S-adenosyl-L-homocysteine zwitterion (CHEBI:57856) |
| Incoming Relation(s) |
| S-adenosyl-L-homocysteinate (CHEBI:67009) is conjugate base of S-adenosyl-L-homocysteine (CHEBI:16680) |
| S-adenosyl-L-homocysteine zwitterion (CHEBI:57856) is tautomer of S-adenosyl-L-homocysteine (CHEBI:16680) |
| IUPAC Name |
|---|
| S-(5'-deoxyadenosin-5'-yl)-L-homocysteine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-({[(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl}sulfanyl)butanoic acid | PDBeChem |
| 2-S-adenosyl-L-homocysteine | HMDB |
| adenosylhomocysteine | MetaCyc |
| Adenosyl-L-homocysteine | HMDB |
| AdoHcy | ChEBI |
| S-[1-(adenin-9-yl)-1,5-dideoxy-β-D-ribofuranos-5-yl]-L-homocysteine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| ADENOSYL-HOMO-CYS | MetaCyc |
| C00007230 | KNApSAcK |
| C00021 | KEGG COMPOUND |
| DB01752 | DrugBank |
| HMDB0000939 | HMDB |
| S-Adenosyl-L-homocysteine | Wikipedia |
| SAH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:692100 | Gmelin |
| Reaxys:99188 | Reaxys |
| CAS:979-92-0 | KEGG COMPOUND |
| CAS:979-92-0 | ChemIDplus |
| Citations |
|---|