EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34NO15 |
| Net Charge | 0 |
| Average Mass | 528.484 |
| Monoisotopic Mass | 528.19284 |
| SMILES | *[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@H]2O)[C@H](O)[C@H]1NC(C)=O |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. xenoantigen An antigen that is found in more than one species. carbohydrate allergen Any carbohydrate, carbohydrate derivative or derived substituent group which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc-yl group (CHEBI:12308) has role carbohydrate allergen (CHEBI:143231) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc-yl group (CHEBI:12308) has role epitope (CHEBI:53000) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc-yl group (CHEBI:12308) is a N-acetyl-β-D-glucosaminyl group (CHEBI:55471) |
| α-D-Galp-(1→3)-β-D-Galp-(1→4)-β-D-GlcpNAc-yl group (CHEBI:12308) is a α-D-Galp-(1→3)-β-D-Galp-(1→4)-D-GlcpNAc-yl group (CHEBI:17785) |
| IUPAC Name |
|---|
| α-D-galactopyranosyl-(1→3)-β-D-galactopyranosyl-(1→4)-2-acetamido-2-deoxy-β-D-glucopyranosyl |
| Synonyms | Source |
|---|---|
| α-Gal | ChEBI |
| α-Gal trisaccharide | ChEBI |
| α-Gal trisaccharide epitope | ChEBI |
| α-D-Gal-(1→3)-β-D-Gal-(1→4)-β-D-GlcNAc-yl group | ChEBI |
| α-D-galactosyl-(1→3)-β-D-galactosyl-(1→4)-β-N-acetylglucosaminyl | ChEBI |
| α-D-galactosyl-(1→3)-β-D-galactosyl-(1→4)-β-N-acetylglucosaminyl group | ChEBI |
| Citations |
|---|