EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6NO4 |
| Net Charge | -1 |
| Average Mass | 192.150 |
| Monoisotopic Mass | 192.03023 |
| SMILES | O=C([O-])c1cc2cc(O)c(O)cc2n1 |
| InChI | InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14)/p-1 |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) has role human metabolite (CHEBI:77746) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is a dihydroxyindole (CHEBI:23781) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is a indolecarboxylate (CHEBI:38609) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is conjugate acid of 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is conjugate base of 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) |
| Incoming Relation(s) |
| indole-5,6-quinone-2-carboxylate (CHEBI:177869) has functional parent 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) |
| 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) is conjugate acid of 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) |
| 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) is conjugate base of 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-1H-indole-2-carboxylate |
| UniProt Name | Source |
|---|---|
| 5,6-dihydroxyindole-2-carboxylate | UniProt |