EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H4NO4 |
| Net Charge | -3 |
| Average Mass | 190.134 |
| Monoisotopic Mass | 190.01568 |
| SMILES | O=C([O-])c1cc2cc([O-])c([O-])cc2n1 |
| InChI | InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14)/p-3 |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) is a dihydroxyindole (CHEBI:23781) |
| 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) is a indolecarboxylate (CHEBI:38609) |
| 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) is conjugate base of 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) |
| Incoming Relation(s) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is conjugate acid of 5,6-dioxidoindole-2-carboxylate (CHEBI:20515) |
| IUPAC Name |
|---|
| 5,6-dioxido-1H-indole-2-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2470948 | Gmelin |