EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO4 |
| Net Charge | 0 |
| Average Mass | 193.158 |
| Monoisotopic Mass | 193.03751 |
| SMILES | O=C(O)c1cc2cc(O)c(O)cc2n1 |
| InChI | InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h1-3,10-12H,(H,13,14) |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) has role mouse metabolite (CHEBI:75771) |
| 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) is a dihydroxyindole (CHEBI:23781) |
| 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) is conjugate acid of 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) |
| 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) is tautomer of dopachrome (CHEBI:49108) |
| Incoming Relation(s) |
| indole-5,6-quinone-2-carboxylic acid (CHEBI:81394) has functional parent 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) |
| 5,6-dihydroxyindole-2-carboxylate (CHEBI:16875) is conjugate base of 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) |
| dopachrome (CHEBI:49108) is tautomer of 5,6-dihydroxyindole-2-carboxylic acid (CHEBI:2003) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-1H-indole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5,6-DHICA | ChemIDplus |
| 5,6-dihydroxy-2-indolecarboxylic acid | ChemIDplus |
| 5,6-dihydroxy-2-indolylcarboxylic acid | ChemIDplus |
| 5,6-Dihydroxyindole-2-carboxylate | KEGG COMPOUND |
| DHI2C | ChemIDplus |
| DHICA | KEGG COMPOUND |
| Citations |
|---|