EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O2S |
| Net Charge | 0 |
| Average Mass | 241.316 |
| Monoisotopic Mass | 241.08850 |
| SMILES | CCCCNC(=S)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C10H15N3O2S/c1-2-3-6-11-10(16)13-12-9(14)8-5-4-7-15-8/h4-5,7H,2-3,6H2,1H3,(H,12,14)(H2,11,13,16) |
| InChIKey | NOOUPGABZCUYOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-butyl-3-[[2-furanyl(oxo)methyl]amino]thiourea (CHEBI:120622) is a furoic acid (CHEBI:36055) |
| Manual Xrefs | Databases |
|---|---|
| LSM-32064 | LINCS |