EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O3 |
| Net Charge | -1 |
| Average Mass | 163.152 |
| Monoisotopic Mass | 163.04007 |
| SMILES | [H]C(=Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/p-1 |
| InChIKey | NGSWKAQJJWESNS-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-coumarate (CHEBI:32373) has role plant metabolite (CHEBI:76924) |
| 4-coumarate (CHEBI:32373) is a coumarate (CHEBI:23399) |
| 4-coumarate (CHEBI:32373) is conjugate base of 4-coumaric acid (CHEBI:36090) |
| Incoming Relation(s) |
| 4-O-β-D-glucosyl-4-coumarate (CHEBI:47893) has functional parent 4-coumarate (CHEBI:32373) |
| trans-4-coumarate (CHEBI:12876) is a 4-coumarate (CHEBI:32373) |
| 4-coumaric acid (CHEBI:36090) is conjugate acid of 4-coumarate (CHEBI:32373) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxyphenyl)acrylate | ChEBI |
| 4-hydroxycinnamate anion | ChEBI |
| p-coumarate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-coumarate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12142331 | Reaxys |
| Gmelin:2565912 | Gmelin |