EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30N2O4 |
| Net Charge | 0 |
| Average Mass | 506.602 |
| Monoisotopic Mass | 506.22056 |
| SMILES | CC1(OC(=O)CCc2ccccc2)C(=O)C=C2C=C(c3ccc(C#N)cc3)N(C3CCCCC3)C=C2C1=O |
| InChI | InChI=1S/C32H30N2O4/c1-32(38-30(36)17-14-22-8-4-2-5-9-22)29(35)19-25-18-28(24-15-12-23(20-33)13-16-24)34(21-27(25)31(32)37)26-10-6-3-7-11-26/h2,4-5,8-9,12-13,15-16,18-19,21,26H,3,6-7,10-11,14,17H2,1H3 |
| InChIKey | FCBMPROIKFXPAS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenylpropanoic acid [3-(4-cyanophenyl)-2-cyclohexyl-7-methyl-6,8-dioxo-7-isoquinolinyl] ester (CHEBI:117128) is a azaphilone (CHEBI:50941) |
| Manual Xrefs | Databases |
|---|---|
| LSM-28577 | LINCS |