EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3 |
| InChIKey | LUJAXSNNYBCFEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) has functional parent quercetin (CHEBI:16243) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) has role metabolite (CHEBI:25212) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) is a dimethoxyflavone (CHEBI:23798) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) is a trihydroxyflavone (CHEBI:27116) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) is conjugate acid of 3',4',5-trihydroxy-3,7-dimethoxyflavone(1−) (CHEBI:77710) |
| Incoming Relation(s) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone(1−) (CHEBI:77710) is conjugate base of 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',4',5-Trihydroxy-3,7-dimethoxyflavone | KEGG COMPOUND |
| 3,7-Di-O-methylquercetin | KEGG COMPOUND |
| 3,7-O-dimethylquercetin | ChEBI |
| 2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4-benzopyrone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01265 | KEGG COMPOUND |
| 345-TRIHYDROXY-37-DIMETHOXYFLAVONE | MetaCyc |
| C00004638 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:338444 | Reaxys |
| CAS:2068-02-2 | KEGG COMPOUND |
| CAS:2068-02-2 | ChemIDplus |
| Citations |
|---|