EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13O7 |
| Net Charge | -1 |
| Average Mass | 329.284 |
| Monoisotopic Mass | 329.06668 |
| SMILES | COc1cc([O-])c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3/p-1 |
| InChIKey | LUJAXSNNYBCFEE-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone(1−) (CHEBI:77710) is a flavonoid oxoanion (CHEBI:60038) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone(1−) (CHEBI:77710) is conjugate base of 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) |
| Incoming Relation(s) |
| 3',4',5-trihydroxy-3,7-dimethoxyflavone (CHEBI:18010) is conjugate acid of 3',4',5-trihydroxy-3,7-dimethoxyflavone(1−) (CHEBI:77710) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,7-dimethoxy-4-oxo-4H-chromen-5-olate |
| UniProt Name | Source |
|---|---|
| 3',4',5-trihydroxy-3,7-dimethoxyflavone | UniProt |