EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O |
| Net Charge | 0 |
| Average Mass | 86.134 |
| Monoisotopic Mass | 86.07316 |
| SMILES | [H]C(=O)C(C)CC |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h4-5H,3H2,1-2H3 |
| InChIKey | BYGQBDHUGHBGMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Olea europaea (ncbitaxon:4146) | - | PubMed (24295708) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylbutanal (CHEBI:16182) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-methylbutanal (CHEBI:16182) has role plant metabolite (CHEBI:76924) |
| 2-methylbutanal (CHEBI:16182) has role volatile oil component (CHEBI:27311) |
| 2-methylbutanal (CHEBI:16182) is a 2-methyl-branched fatty aldehyde (CHEBI:49188) |
| 2-methylbutanal (CHEBI:16182) is a methylbutanal (CHEBI:25282) |
| Incoming Relation(s) |
| 2-methylbutanal oxime (CHEBI:61134) has functional parent 2-methylbutanal (CHEBI:16182) |
| (S)-2-methylbutanal (CHEBI:88414) is a 2-methylbutanal (CHEBI:16182) |
| IUPAC Name |
|---|
| 2-methylbutanal |
| Synonyms | Source |
|---|---|
| 2-Methylbutanal | KEGG COMPOUND |
| 2-methylbutyraldehyde | ChEBI |
| 2-Methylbutyraldehyde | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-methylbutanal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02223 | KEGG COMPOUND |
| HMDB0031526 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1633540 | Reaxys |
| CAS:96-17-3 | ChemIDplus |
| CAS:96-17-3 | KEGG COMPOUND |
| Citations |
|---|