EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O |
| Net Charge | 0 |
| Average Mass | 86.134 |
| Monoisotopic Mass | 86.07316 |
| SMILES | [H]C(=O)[C@@H](C)CC |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h4-5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | BYGQBDHUGHBGMD-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (17314143) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-methylbutanal (CHEBI:88414) is a 2-methylbutanal (CHEBI:16182) |
| Incoming Relation(s) |
| (1E,2S)-2-methylbutanal oxime (CHEBI:134628) has functional parent (S)-2-methylbutanal (CHEBI:88414) |
| (1Z,2S)-2-methylbutanal oxime (CHEBI:134629) has functional parent (S)-2-methylbutanal (CHEBI:88414) |
| IUPAC Name |
|---|
| (2S)-2-methylbutanal |
| Synonyms | Source |
|---|---|
| (2S)-2-methylbutyraldehyde | ChEBI |
| (2S)-2-methylbutyric aldehyde | ChEBI |
| (S)-2-methylbutyraldehyde | ChEBI |
| (S)-2-methylbutyric aldehyde | ChEBI |
| (S)-α-methylbutyric aldehyde | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031525 | HMDB |
| Citations |
|---|