EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O5.Na |
| Net Charge | 0 |
| Average Mass | 192.102 |
| Monoisotopic Mass | 192.00347 |
| SMILES | O=C([O-])c1cc(O)c(O)c(O)c1.[Na+] |
| InChI | InChI=1S/C7H6O5.Na/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);/q;+1/p-1 |
| InChIKey | FZHLWVUAICIIPW-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 15-lipoxygenase (EC 1.13.11.33). cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium gallate (CHEBI:115197) has part gallate (CHEBI:16918) |
| sodium gallate (CHEBI:115197) has role antineoplastic agent (CHEBI:35610) |
| sodium gallate (CHEBI:115197) has role antioxidant (CHEBI:22586) |
| sodium gallate (CHEBI:115197) has role apoptosis inducer (CHEBI:68495) |
| sodium gallate (CHEBI:115197) has role astringent (CHEBI:74783) |
| sodium gallate (CHEBI:115197) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| sodium gallate (CHEBI:115197) has role EC 1.13.11.33 (arachidonate 15-lipoxygenase) inhibitor (CHEBI:64996) |
| sodium gallate (CHEBI:115197) has role human xenobiotic metabolite (CHEBI:76967) |
| sodium gallate (CHEBI:115197) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3,4,5-trihydroxybenzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27774820 | Reaxys |
| CAS:2053-21-6 | ChemIDplus |
| Citations |
|---|