EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16F3N5O5 |
| Net Charge | 0 |
| Average Mass | 415.328 |
| Monoisotopic Mass | 415.11035 |
| SMILES | CC1=NN(C(=O)c2ccc(Cn3nc(C)c([N+](=O)[O-])c3C)o2)C(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H16F3N5O5/c1-8-6-15(26,16(17,18)19)23(20-8)14(25)12-5-4-11(29-12)7-22-10(3)13(24(27)28)9(2)21-22/h4-5,26H,6-7H2,1-3H3 |
| InChIKey | FUHDQGAGIQCGHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [5-[(3,5-dimethyl-4-nitro-1-pyrazolyl)methyl]-2-furanyl]-[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]methanone (CHEBI:114212) is a furoic acid (CHEBI:36055) |
| Manual Xrefs | Databases |
|---|---|
| LSM-25673 | LINCS |