EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14BrN3O2S |
| Net Charge | 0 |
| Average Mass | 368.256 |
| Monoisotopic Mass | 366.99901 |
| SMILES | Cc1ccc(C)c(NC(=S)NNC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C14H14BrN3O2S/c1-8-3-4-9(2)10(7-8)16-14(21)18-17-13(19)11-5-6-12(15)20-11/h3-7H,1-2H3,(H,17,19)(H2,16,18,21) |
| InChIKey | ZBCDIULMPGHKDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[[(5-bromo-2-furanyl)-oxomethyl]amino]-3-(2,5-dimethylphenyl)thiourea (CHEBI:109654) is a furoic acid (CHEBI:36055) |
| Manual Xrefs | Databases |
|---|---|
| LSM-21082 | LINCS |