EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H]1O[C@H]1CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18-19(23-18)16-14-17-20(21)22/h6-7,9-13,15,18-19H,2-5,8,14,16-17H2,1H3,(H,21,22)/b7-6-,10-9-,12-11+,15-13+/t18-,19-/m0/s1 |
| InChIKey | UFPQIRYSPUYQHK-WAQVJNLQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Phaseolus vulgaris (ncbitaxon:3885) | - | DOI (10.3390/ijms19041049) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene A4 (CHEBI:15651) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene A4 (CHEBI:15651) has role human metabolite (CHEBI:77746) |
| leukotriene A4 (CHEBI:15651) has role mouse metabolite (CHEBI:75771) |
| leukotriene A4 (CHEBI:15651) has role plant metabolite (CHEBI:76924) |
| leukotriene A4 (CHEBI:15651) is a epoxy fatty acid (CHEBI:61498) |
| leukotriene A4 (CHEBI:15651) is a leukotriene (CHEBI:25029) |
| leukotriene A4 (CHEBI:15651) is a long-chain fatty acid (CHEBI:15904) |
| leukotriene A4 (CHEBI:15651) is a oxylipin (CHEBI:61121) |
| leukotriene A4 (CHEBI:15651) is a polyunsaturated fatty acid (CHEBI:26208) |
| leukotriene A4 (CHEBI:15651) is conjugate acid of leukotriene A4(1−) (CHEBI:57463) |
| Incoming Relation(s) |
| 4,5-leukotriene A4 (CHEBI:28367) has functional parent leukotriene A4 (CHEBI:15651) |
| leukotriene A4(1−) (CHEBI:57463) is conjugate base of leukotriene A4 (CHEBI:15651) |
| IUPAC Name |
|---|
| (5S,6S,7E,9E,11Z,14Z)-5,6-epoxyicosa-7,9,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| Leukotriene A4 | KEGG COMPOUND |
| LTA4 | KEGG COMPOUND |
| (7E,9E,11Z,14Z)-(5S,6S)-5,6-epoxyeicosa-7,9,11,14-tetraenoic acid | KEGG COMPOUND |
| 5S,6S-epoxy-7E,9E,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| Oxiranebutanoic acid, 3-(1,3,5,8-tetradecatetraenyl)-, (2S-(2alpha,3beta(1E,3Z,5Z,8Z)))- | ChemIDplus |
| 5S,6S-leukotriene A4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00909 | KEGG COMPOUND |
| LMFA03020023 | LIPID MAPS |
| DJ3 | PDBeChem |
| HMDB0001337 | HMDB |
| C00053424 | KNApSAcK |
| Leukotriene_A4 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5756170 | Reaxys |
| CAS:72059-45-1 | KEGG COMPOUND |
| CAS:72059-45-1 | ChemIDplus |
| Citations |
|---|